C13H14ClNO4S2 — CID 51094585
N-[3-chloro-2-(2-methoxyethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 51094585) has the molecular formula C13H14ClNO4S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is N-[3-chloro-2-(2-methoxyethoxy)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 51094585 |
| Molecular Formula | C13H14ClNO4S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | COCCOc1c(Cl)cccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H14ClNO4S2/c1-18-7-8-19-13-10(14)4-2-5-11(13)15-21(16,17)12-6-3-9-20-12/h2-6,9,15H,7-8H2,1H3 |
| InChIKey | KTHXVWOEUASOOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|