C18H23Cl3Si3 — CID 173365365
[(Z)-1,2-bis[chloromethyl(phenyl)silyl]ethenyl]-chloro-dimethylsilane (PubChem CID 173365365) has the molecular formula C18H23Cl3Si3 and a molecular weight of 430.00 g/mol. Its IUPAC name is [(Z)-1,2-bis[chloromethyl(phenyl)silyl]ethenyl]-chloro-dimethylsilane.
| Compound Name | [(Z)-1,2-bis[chloromethyl(phenyl)silyl]ethenyl]-chloro-dimethylsilane |
|---|---|
| PubChem CID | 173365365 |
| Molecular Formula | C18H23Cl3Si3 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | [(Z)-1,2-bis[chloromethyl(phenyl)silyl]ethenyl]-chloro-dimethylsilane |
| SMILES | C[Si](C)(Cl)/C(=C\[SiH](CCl)c1ccccc1)[SiH](CCl)c1ccccc1 |
| InChI | InChI=1S/C18H23Cl3Si3/c1-24(2,21)18(23(15-20)17-11-7-4-8-12-17)13-22(14-19)16-9-5-3-6-10-16/h3-13,22-23H,14-15H2,1-2H3/b18-13- |
| InChIKey | KQFKTBUSQFJMHD-AQTBWJFISA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|