C23H22N2SSi — CID 173368082
4-[[imidazol-1-yl(diphenyl)methyl]-methylsilyl]cyclohexa-2,4-diene-1-thione (PubChem CID 173368082) has the molecular formula C23H22N2SSi and a molecular weight of 386.60 g/mol. Its IUPAC name is 4-[[imidazol-1-yl(diphenyl)methyl]-methylsilyl]cyclohexa-2,4-diene-1-thione.
| Compound Name | 4-[[imidazol-1-yl(diphenyl)methyl]-methylsilyl]cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 173368082 |
| Molecular Formula | C23H22N2SSi |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[[imidazol-1-yl(diphenyl)methyl]-methylsilyl]cyclohexa-2,4-diene-1-thione |
| SMILES | C[SiH](C1=CCC(=S)C=C1)C(c1ccccc1)(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C23H22N2SSi/c1-27(22-14-12-21(26)13-15-22)23(25-17-16-24-18-25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-12,14-18,27H,13H2,1H3 |
| InChIKey | VYMBKDUGVQNVJM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|