C25H26N2SSi — CID 173367971
3-[[imidazol-1-yl(diphenyl)methyl]-propylsilyl]cyclohexa-2,4-diene-1-thione (PubChem CID 173367971) has the molecular formula C25H26N2SSi and a molecular weight of 414.65 g/mol. Its IUPAC name is 3-[[imidazol-1-yl(diphenyl)methyl]-propylsilyl]cyclohexa-2,4-diene-1-thione.
| Compound Name | 3-[[imidazol-1-yl(diphenyl)methyl]-propylsilyl]cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 173367971 |
| Molecular Formula | C25H26N2SSi |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-[[imidazol-1-yl(diphenyl)methyl]-propylsilyl]cyclohexa-2,4-diene-1-thione |
| SMILES | CCC[SiH](C1=CC(=S)CC=C1)C(c1ccccc1)(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C25H26N2SSi/c1-2-18-29(24-15-9-14-23(28)19-24)25(27-17-16-26-20-27,21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-13,15-17,19-20,29H,2,14,18H2,1H3 |
| InChIKey | HISYDDYKSPDULS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|