C20H22N2Si — CID 173368026
[imidazol-1-yl(diphenyl)methyl]-methyl-prop-2-enylsilane (PubChem CID 173368026) has the molecular formula C20H22N2Si and a molecular weight of 318.50 g/mol. Its IUPAC name is [imidazol-1-yl(diphenyl)methyl]-methyl-prop-2-enylsilane.
| Compound Name | [imidazol-1-yl(diphenyl)methyl]-methyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 173368026 |
| Molecular Formula | C20H22N2Si |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [imidazol-1-yl(diphenyl)methyl]-methyl-prop-2-enylsilane |
| SMILES | C=CC[SiH](C)C(c1ccccc1)(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C20H22N2Si/c1-3-16-23(2)20(22-15-14-21-17-22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h3-15,17,23H,1,16H2,2H3 |
| InChIKey | YTEGYRVSHDQHAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|