C29H38N2O2 — CID 173369438
N'-(1-cyclohexyl-2-oxo-1-phenylpropyl)-N-(cyclopentylmethyl)-N'-phenylacetohydrazide (PubChem CID 173369438) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N'-(1-cyclohexyl-2-oxo-1-phenylpropyl)-N-(cyclopentylmethyl)-N'-phenylacetohydrazide.
| Compound Name | N'-(1-cyclohexyl-2-oxo-1-phenylpropyl)-N-(cyclopentylmethyl)-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 173369438 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | N'-(1-cyclohexyl-2-oxo-1-phenylpropyl)-N-(cyclopentylmethyl)-N'-phenylacetohydrazide |
| SMILES | CC(=O)N(CC1CCCC1)N(c1ccccc1)C(C(C)=O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H38N2O2/c1-23(32)29(26-16-6-3-7-17-26,27-18-8-4-9-19-27)31(28-20-10-5-11-21-28)30(24(2)33)22-25-14-12-13-15-25/h3,5-7,10-11,16-17,20-21,25,27H,4,8-9,12-15,18-19,22H2,1-2H3 |
| InChIKey | JDEJUGIZJNRXKM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|