C14H33O6PSi — CID 173377300
1-[diethoxyphosphoryl(dimethylsilyloxy)methoxy]-4,4-dimethylpentan-2-ol (PubChem CID 173377300) has the molecular formula C14H33O6PSi and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[diethoxyphosphoryl(dimethylsilyloxy)methoxy]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[diethoxyphosphoryl(dimethylsilyloxy)methoxy]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 173377300 |
| Molecular Formula | C14H33O6PSi |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[diethoxyphosphoryl(dimethylsilyloxy)methoxy]-4,4-dimethylpentan-2-ol |
| SMILES | CCOP(=O)(OCC)C(OCC(O)CC(C)(C)C)O[SiH](C)C |
| InChI | InChI=1S/C14H33O6PSi/c1-8-18-21(16,19-9-2)13(20-22(6)7)17-11-12(15)10-14(3,4)5/h12-13,15,22H,8-11H2,1-7H3 |
| InChIKey | HLYPGPJODATRSH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|