C15H36NO5PSi — CID 173368464
O-[2-(2-diethoxyphosphorylethyl)-3-dimethylsilyloxy-4,4-dimethylpentyl]hydroxylamine (PubChem CID 173368464) has the molecular formula C15H36NO5PSi and a molecular weight of 369.52 g/mol. Its IUPAC name is O-[2-(2-diethoxyphosphorylethyl)-3-dimethylsilyloxy-4,4-dimethylpentyl]hydroxylamine.
| Compound Name | O-[2-(2-diethoxyphosphorylethyl)-3-dimethylsilyloxy-4,4-dimethylpentyl]hydroxylamine |
|---|---|
| PubChem CID | 173368464 |
| Molecular Formula | C15H36NO5PSi |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | O-[2-(2-diethoxyphosphorylethyl)-3-dimethylsilyloxy-4,4-dimethylpentyl]hydroxylamine |
| SMILES | CCOP(=O)(CCC(CON)C(O[SiH](C)C)C(C)(C)C)OCC |
| InChI | InChI=1S/C15H36NO5PSi/c1-8-19-22(17,20-9-2)11-10-13(12-18-16)14(15(3,4)5)21-23(6)7/h13-14,23H,8-12,16H2,1-7H3 |
| InChIKey | FCNZLYCMJZFWMG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|