About difluoro(undecyl)silane
difluoro(undecyl)silane (PubChem CID 173381028) has the molecular formula C11H24F2Si
and a molecular weight of 222.39 g/mol. Its IUPAC name is difluoro(undecyl)silane.
Molecular Properties
| Compound Name | difluoro(undecyl)silane |
| PubChem CID | 173381028 |
| Molecular Formula | C11H24F2Si |
| Molecular Weight | 222.39 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | difluoro(undecyl)silane |
| SMILES | CCCCCCCCCCC[SiH](F)F |
| InChI | InChI=1S/C11H24F2Si/c1-2-3-4-5-6-7-8-9-10-11-14(12)13/h14H,2-11H2,1H3 |
| InChIKey | NYHZITFSHIHQJR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze difluoro(undecyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(undecyl)silane?
The IUPAC name of difluoro(undecyl)silane (CID 173381028) is difluoro(undecyl)silane.
What is the SMILES notation for difluoro(undecyl)silane?
The canonical SMILES for difluoro(undecyl)silane is CCCCCCCCCCC[SiH](F)F.
What is the InChIKey of difluoro(undecyl)silane?
The InChIKey is NYHZITFSHIHQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24F2Si/c1-2-3-4-5-6-7-8-9-10-11-14(12)13/h14H,2-11H2,1H3.
What are the key properties of difluoro(undecyl)silane?
difluoro(undecyl)silane has a molecular weight of 222.39 g/mol, XLogP of 4.68, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(undecyl)silane is sourced from PubChem (CID 173381028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).