C41H76N2O6S — CID 173381241
1-(1-methyl-3-octadec-9-enoyl-4,5-dihydroimidazol-1-ium-2-yl)octadec-9-en-1-one;methyl sulfate (PubChem CID 173381241) has the molecular formula C41H76N2O6S and a molecular weight of 725.13 g/mol. Its IUPAC name is 1-(1-methyl-3-octadec-9-enoyl-4,5-dihydroimidazol-1-ium-2-yl)octadec-9-en-1-one;methyl sulfate.
| Compound Name | 1-(1-methyl-3-octadec-9-enoyl-4,5-dihydroimidazol-1-ium-2-yl)octadec-9-en-1-one;methyl sulfate |
|---|---|
| PubChem CID | 173381241 |
| Molecular Formula | C41H76N2O6S |
| Molecular Weight | 725.13 g/mol |
| Exact Mass | 724.54 |
| IUPAC Name | 1-(1-methyl-3-octadec-9-enoyl-4,5-dihydroimidazol-1-ium-2-yl)octadec-9-en-1-one;methyl sulfate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C1=[N+](C)CCN1C(=O)CCCCCCCC=CCCCCCCCC.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C40H73N2O2.CH4O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(43)40-41(3)36-37-42(40)39(44)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5-6(2,3)4/h18-21H,4-17,22-37H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | KTQREYNQVUDFKI-UHFFFAOYSA-M |
| XLogP | 10.61 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.13 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|