C33H51ClN2O4Si — CID 173382289
2-trimethylsilylethyl 3-chloro-4,6-dimethyl-2-[(3E,7E)-2-(2-oxo-2-piperidin-1-ylethoxy)iminododeca-3,7-dienyl]benzoate (PubChem CID 173382289) has the molecular formula C33H51ClN2O4Si and a molecular weight of 603.32 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-chloro-4,6-dimethyl-2-[(3E,7E)-2-(2-oxo-2-piperidin-1-ylethoxy)iminododeca-3,7-dienyl]benzoate.
| Compound Name | 2-trimethylsilylethyl 3-chloro-4,6-dimethyl-2-[(3E,7E)-2-(2-oxo-2-piperidin-1-ylethoxy)iminododeca-3,7-dienyl]benzoate |
|---|---|
| PubChem CID | 173382289 |
| Molecular Formula | C33H51ClN2O4Si |
| Molecular Weight | 603.32 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 2-trimethylsilylethyl 3-chloro-4,6-dimethyl-2-[(3E,7E)-2-(2-oxo-2-piperidin-1-ylethoxy)iminododeca-3,7-dienyl]benzoate |
| SMILES | CCCC/C=C/CC/C=C/C(Cc1c(Cl)c(C)cc(C)c1C(=O)OCC[Si](C)(C)C)=NOCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C33H51ClN2O4Si/c1-7-8-9-10-11-12-13-15-18-28(35-40-25-30(37)36-19-16-14-17-20-36)24-29-31(26(2)23-27(3)32(29)34)33(38)39-21-22-41(4,5)6/h10-11,15,18,23H,7-9,12-14,16-17,19-22,24-25H2,1-6H3/b11-10+,18-15+,35-28? |
| InChIKey | OIXSRTLBZXNQCV-QBXWNPCVSA-N |
| XLogP | 8.46 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.32 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|