C47H65ClN2O5Si2 — CID 91221353
2-trimethylsilylethyl 2-[(3E,7E)-10-[tert-butyl(diphenyl)silyl]oxy-2-(2-oxo-2-piperidin-1-ylethoxy)iminodeca-3,7-dienyl]-3-chloro-4,6-dimethylbenzoate (PubChem CID 91221353) has the molecular formula C47H65ClN2O5Si2 and a molecular weight of 829.67 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(3E,7E)-10-[tert-butyl(diphenyl)silyl]oxy-2-(2-oxo-2-piperidin-1-ylethoxy)iminodeca-3,7-dienyl]-3-chloro-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(3E,7E)-10-[tert-butyl(diphenyl)silyl]oxy-2-(2-oxo-2-piperidin-1-ylethoxy)iminodeca-3,7-dienyl]-3-chloro-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 91221353 |
| Molecular Formula | C47H65ClN2O5Si2 |
| Molecular Weight | 829.67 g/mol |
| Exact Mass | 828.41 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(3E,7E)-10-[tert-butyl(diphenyl)silyl]oxy-2-(2-oxo-2-piperidin-1-ylethoxy)iminodeca-3,7-dienyl]-3-chloro-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC[Si](C)(C)C)c(CC(/C=C/CC/C=C/CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=NOCC(=O)N2CCCCC2)c1Cl |
| InChI | InChI=1S/C47H65ClN2O5Si2/c1-37-34-38(2)45(48)42(44(37)46(52)53-32-33-56(6,7)8)35-39(49-54-36-43(51)50-29-21-15-22-30-50)24-16-11-9-10-12-23-31-55-57(47(3,4)5,40-25-17-13-18-26-40)41-27-19-14-20-28-41/h10,12-14,16-20,24-28,34H,9,11,15,21-23,29-33,35-36H2,1-8H3/b12-10+,24-16+,49-39? |
| InChIKey | UJQZBTSNJOLVNU-CHUHHXPMSA-N |
| XLogP | 10.24 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.67 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|