C26H34N2O6 — CID 123890274
but-3-enyl 2,4-dihydroxy-6-[2-(2-oxo-2-piperidin-1-ylethoxy)iminoocta-3,7-dienyl]benzoate (PubChem CID 123890274) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is but-3-enyl 2,4-dihydroxy-6-[2-(2-oxo-2-piperidin-1-ylethoxy)iminoocta-3,7-dienyl]benzoate.
| Compound Name | but-3-enyl 2,4-dihydroxy-6-[2-(2-oxo-2-piperidin-1-ylethoxy)iminoocta-3,7-dienyl]benzoate |
|---|---|
| PubChem CID | 123890274 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | but-3-enyl 2,4-dihydroxy-6-[2-(2-oxo-2-piperidin-1-ylethoxy)iminoocta-3,7-dienyl]benzoate |
| SMILES | C=CCCC=CC(Cc1cc(O)cc(O)c1C(=O)OCCC=C)=NOCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H34N2O6/c1-3-5-7-9-12-21(27-34-19-24(31)28-13-10-8-11-14-28)16-20-17-22(29)18-23(30)25(20)26(32)33-15-6-4-2/h3-4,9,12,17-18,29-30H,1-2,5-8,10-11,13-16,19H2 |
| InChIKey | GLRIXYBSLRGRLZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|