C29H45NO9Si — CID 58421915
2-[(Z)-[(3E)-1-[3,5-bis(ethoxymethoxy)-2-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-3,7-dien-2-ylidene]amino]oxyacetic acid (PubChem CID 58421915) has the molecular formula C29H45NO9Si and a molecular weight of 579.76 g/mol. Its IUPAC name is 2-[(Z)-[(3E)-1-[3,5-bis(ethoxymethoxy)-2-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-3,7-dien-2-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(Z)-[(3E)-1-[3,5-bis(ethoxymethoxy)-2-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-3,7-dien-2-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 58421915 |
| Molecular Formula | C29H45NO9Si |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 2-[(Z)-[(3E)-1-[3,5-bis(ethoxymethoxy)-2-(2-trimethylsilylethoxycarbonyl)phenyl]-6-methylocta-3,7-dien-2-ylidene]amino]oxyacetic acid |
| SMILES | C=CC(C)C/C=C/C(Cc1cc(OCOCC)cc(OCOCC)c1C(=O)OCC[Si](C)(C)C)=N\OCC(=O)O |
| InChI | InChI=1S/C29H45NO9Si/c1-8-22(4)12-11-13-24(30-39-19-27(31)32)16-23-17-25(37-20-34-9-2)18-26(38-21-35-10-3)28(23)29(33)36-14-15-40(5,6)7/h8,11,13,17-18,22H,1,9-10,12,14-16,19-21H2,2-7H3,(H,31,32)/b13-11+,30-24+ |
| InChIKey | QAEXLEWUUDGAJL-NZGMUHMVSA-N |
| XLogP | 5.70 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|