About ethene;S-(methylsilylmethyl) propanethioate;oxocobalt
ethene;S-(methylsilylmethyl) propanethioate;oxocobalt (PubChem CID 173382313) has the molecular formula C7H14CoO2SSi-2
and a molecular weight of 249.27 g/mol. Its IUPAC name is ethene;S-(methylsilylmethyl) propanethioate;oxocobalt.
Molecular Properties
| Compound Name | ethene;S-(methylsilylmethyl) propanethioate;oxocobalt |
| PubChem CID | 173382313 |
| Molecular Formula | C7H14CoO2SSi-2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | ethene;S-(methylsilylmethyl) propanethioate;oxocobalt |
| SMILES | O=[Co].[CH2-]CC(=O)SC[SiH2]C.[H][C-]=C |
| InChI | InChI=1S/C5H11OSSi.C2H3.Co.O/c1-3-5(6)7-4-8-2;1-2;;/h1,3-4,8H2,2H3;1H,2H2;;/q2*-1;; |
| InChIKey | YUMFZFGSQZFXPV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethene;S-(methylsilylmethyl) propanethioate;oxocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;S-(methylsilylmethyl) propanethioate;oxocobalt?
The IUPAC name of ethene;S-(methylsilylmethyl) propanethioate;oxocobalt (CID 173382313) is ethene;S-(methylsilylmethyl) propanethioate;oxocobalt.
What is the SMILES notation for ethene;S-(methylsilylmethyl) propanethioate;oxocobalt?
The canonical SMILES for ethene;S-(methylsilylmethyl) propanethioate;oxocobalt is O=[Co].[CH2-]CC(=O)SC[SiH2]C.[H][C-]=C.
What is the InChIKey of ethene;S-(methylsilylmethyl) propanethioate;oxocobalt?
The InChIKey is YUMFZFGSQZFXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11OSSi.C2H3.Co.O/c1-3-5(6)7-4-8-2;1-2;;/h1,3-4,8H2,2H3;1H,2H2;;/q2*-1;;.
What are the key properties of ethene;S-(methylsilylmethyl) propanethioate;oxocobalt?
ethene;S-(methylsilylmethyl) propanethioate;oxocobalt has a molecular weight of 249.27 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;S-(methylsilylmethyl) propanethioate;oxocobalt is sourced from PubChem (CID 173382313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).