About butan-2-one;vanadium
butan-2-one;vanadium (PubChem CID 58623009) has the molecular formula C4H7OV-
and a molecular weight of 122.04 g/mol. Its IUPAC name is butan-2-one;vanadium.
Molecular Properties
| Compound Name | butan-2-one;vanadium |
| PubChem CID | 58623009 |
| Molecular Formula | C4H7OV- |
| Molecular Weight | 122.04 g/mol |
| Exact Mass | 121.99 |
| IUPAC Name | butan-2-one;vanadium |
| SMILES | [CH2-]CC(C)=O.[V] |
| InChI | InChI=1S/C4H7O.V/c1-3-4(2)5;/h1,3H2,2H3;/q-1; |
| InChIKey | AWMWLYZOYKNNKT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.04 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;vanadium?
The IUPAC name of butan-2-one;vanadium (CID 58623009) is butan-2-one;vanadium.
What is the SMILES notation for butan-2-one;vanadium?
The canonical SMILES for butan-2-one;vanadium is [CH2-]CC(C)=O.[V].
What is the InChIKey of butan-2-one;vanadium?
The InChIKey is AWMWLYZOYKNNKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O.V/c1-3-4(2)5;/h1,3H2,2H3;/q-1;.
What are the key properties of butan-2-one;vanadium?
butan-2-one;vanadium has a molecular weight of 122.04 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;vanadium is sourced from PubChem (CID 58623009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).