C18H26Si — CID 173383331
butyl-(2,5-dimethylcyclopenta-1,4-dien-1-yl)-methyl-phenylsilane (PubChem CID 173383331) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is butyl-(2,5-dimethylcyclopenta-1,4-dien-1-yl)-methyl-phenylsilane.
| Compound Name | butyl-(2,5-dimethylcyclopenta-1,4-dien-1-yl)-methyl-phenylsilane |
|---|---|
| PubChem CID | 173383331 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | butyl-(2,5-dimethylcyclopenta-1,4-dien-1-yl)-methyl-phenylsilane |
| SMILES | CCCC[Si](C)(C1=C(C)CC=C1C)c1ccccc1 |
| InChI | InChI=1S/C18H26Si/c1-5-6-14-19(4,17-10-8-7-9-11-17)18-15(2)12-13-16(18)3/h7-12H,5-6,13-14H2,1-4H3 |
| InChIKey | HYHUGVQMSTXLPA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|