C17H24Si — CID 173384313
butyl-methyl-(5-methylcyclopenta-1,4-dien-1-yl)-phenylsilane (PubChem CID 173384313) has the molecular formula C17H24Si and a molecular weight of 256.46 g/mol. Its IUPAC name is butyl-methyl-(5-methylcyclopenta-1,4-dien-1-yl)-phenylsilane.
| Compound Name | butyl-methyl-(5-methylcyclopenta-1,4-dien-1-yl)-phenylsilane |
|---|---|
| PubChem CID | 173384313 |
| Molecular Formula | C17H24Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | butyl-methyl-(5-methylcyclopenta-1,4-dien-1-yl)-phenylsilane |
| SMILES | CCCC[Si](C)(C1=CCC=C1C)c1ccccc1 |
| InChI | InChI=1S/C17H24Si/c1-4-5-14-18(3,16-11-7-6-8-12-16)17-13-9-10-15(17)2/h6-8,10-13H,4-5,9,14H2,1-3H3 |
| InChIKey | SQHPTCRAKPSXGV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|