C22H25Cl3SiTi — CID 173384714
(4-pentyl-3-phenylcyclopenta-1,3-dien-1-yl)-phenylsilane;titanium(4+);trichloride (PubChem CID 173384714) has the molecular formula C22H25Cl3SiTi and a molecular weight of 471.75 g/mol. Its IUPAC name is (4-pentyl-3-phenylcyclopenta-1,3-dien-1-yl)-phenylsilane;titanium(4+);trichloride.
| Compound Name | (4-pentyl-3-phenylcyclopenta-1,3-dien-1-yl)-phenylsilane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 173384714 |
| Molecular Formula | C22H25Cl3SiTi |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | (4-pentyl-3-phenylcyclopenta-1,3-dien-1-yl)-phenylsilane;titanium(4+);trichloride |
| SMILES | CCCCCC1=C(c2ccccc2)[C-]=C([SiH2]c2ccccc2)C1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C22H25Si.3ClH.Ti/c1-2-3-6-13-19-16-21(23-20-14-9-5-10-15-20)17-22(19)18-11-7-4-8-12-18;;;;/h4-5,7-12,14-15H,2-3,6,13,16,23H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | WATMSSJRCWRNPL-UHFFFAOYSA-K |
| XLogP | -4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|