C22H31Cl3SiTi — CID 173384343
[3-butyl-4-(cyclohexylmethyl)cyclopenta-1,3-dien-1-yl]-phenylsilane;titanium(4+);trichloride (PubChem CID 173384343) has the molecular formula C22H31Cl3SiTi and a molecular weight of 477.80 g/mol. Its IUPAC name is [3-butyl-4-(cyclohexylmethyl)cyclopenta-1,3-dien-1-yl]-phenylsilane;titanium(4+);trichloride.
| Compound Name | [3-butyl-4-(cyclohexylmethyl)cyclopenta-1,3-dien-1-yl]-phenylsilane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 173384343 |
| Molecular Formula | C22H31Cl3SiTi |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [3-butyl-4-(cyclohexylmethyl)cyclopenta-1,3-dien-1-yl]-phenylsilane;titanium(4+);trichloride |
| SMILES | CCCCC1=C(CC2CCCCC2)CC([SiH2]c2ccccc2)=[C-]1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C22H31Si.3ClH.Ti/c1-2-3-12-19-16-22(23-21-13-8-5-9-14-21)17-20(19)15-18-10-6-4-7-11-18;;;;/h5,8-9,13-14,18H,2-4,6-7,10-12,15,17,23H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | QTIMPSDUZAFLMH-UHFFFAOYSA-K |
| XLogP | -3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|