C20H27Cl3SiTi — CID 173383507
[2-(cyclohexylmethyl)-3,5-dimethylcyclopenta-2,4-dien-1-yl]-phenylsilane;titanium(4+);trichloride (PubChem CID 173383507) has the molecular formula C20H27Cl3SiTi and a molecular weight of 449.75 g/mol. Its IUPAC name is [2-(cyclohexylmethyl)-3,5-dimethylcyclopenta-2,4-dien-1-yl]-phenylsilane;titanium(4+);trichloride.
| Compound Name | [2-(cyclohexylmethyl)-3,5-dimethylcyclopenta-2,4-dien-1-yl]-phenylsilane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 173383507 |
| Molecular Formula | C20H27Cl3SiTi |
| Molecular Weight | 449.75 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | [2-(cyclohexylmethyl)-3,5-dimethylcyclopenta-2,4-dien-1-yl]-phenylsilane;titanium(4+);trichloride |
| SMILES | CC1=[C-]C(C)=C(CC2CCCCC2)C1[SiH2]c1ccccc1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C20H27Si.3ClH.Ti/c1-15-13-16(2)20(21-18-11-7-4-8-12-18)19(15)14-17-9-5-3-6-10-17;;;;/h4,7-8,11-12,17,20H,3,5-6,9-10,14,21H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | REDONHQNVFTDET-UHFFFAOYSA-K |
| XLogP | -4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.75 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|