C19H26N2OS — CID 17338517
N-(cyclohex-3-en-1-ylmethyl)-N-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 17338517) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-N-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-N-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 17338517 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-N-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | COc1ccc(CN(CC2CC=CCC2)C2=NCCCS2)cc1 |
| InChI | InChI=1S/C19H26N2OS/c1-22-18-10-8-17(9-11-18)15-21(19-20-12-5-13-23-19)14-16-6-3-2-4-7-16/h2-3,8-11,16H,4-7,12-15H2,1H3 |
| InChIKey | FJGVJXVOEFQEOT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|