C20H22ClN3O5 — CID 173387135
CID 173387135 (PubChem CID 173387135) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol.
| Compound Name | CID 173387135 |
|---|---|
| PubChem CID | 173387135 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | — |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N)c3ccccc3c1N2.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C20H21N3O.ClHO4/c1-3-23(4-2)13-9-10-17-18(11-13)24-19-12-16(21)14-7-5-6-8-15(14)20(19)22-17;2-1(3,4)5/h5-12,22H,3-4,21H2,1-2H3;(H,2,3,4,5) |
| InChIKey | ONACPUBUIKICIL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|