C17H18F3N5O6S2 — CID 173389522
(6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173389522) has the molecular formula C17H18F3N5O6S2 and a molecular weight of 509.49 g/mol. Its IUPAC name is (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173389522 |
| Molecular Formula | C17H18F3N5O6S2 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3,4-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(C)(C(=O)O)C(C)S[C@H]12)c1csc(NC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C17H18F3N5O6S2/c1-6-16(2,14(29)30)5-25-11(27)9(12(25)33-6)22-10(26)8(24-31-3)7-4-32-15(21-7)23-13(28)17(18,19)20/h4,6,9,12H,5H2,1-3H3,(H,22,26)(H,29,30)(H,21,23,28)/t6?,9?,12-,16?/m1/s1 |
| InChIKey | PCUXVPTWYNVFKC-XQYYYMLLSA-N |
| XLogP | 0.87 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|