About [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate
[methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate (PubChem CID 173392918) has the molecular formula C30H22F9O3PS
and a molecular weight of 664.53 g/mol. Its IUPAC name is [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate.
Molecular Properties
| Compound Name | [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate |
| PubChem CID | 173392918 |
| Molecular Formula | C30H22F9O3PS |
| Molecular Weight | 664.53 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate |
| SMILES | CP(OS(=O)(=O)C=Cc1ccccc1)(c1ccc(C(F)(F)F)cc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H22F9O3PS/c1-43(25-13-7-22(8-14-25)28(31,32)33,26-15-9-23(10-16-26)29(34,35)36,27-17-11-24(12-18-27)30(37,38)39)42-44(40,41)20-19-21-5-3-2-4-6-21/h2-20H,1H3 |
| InChIKey | YEVIWWWTPLDXNN-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 664.53 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate?
The IUPAC name of [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate (CID 173392918) is [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate.
What is the SMILES notation for [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate?
The canonical SMILES for [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate is CP(OS(=O)(=O)C=Cc1ccccc1)(c1ccc(C(F)(F)F)cc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate?
The InChIKey is YEVIWWWTPLDXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22F9O3PS/c1-43(25-13-7-22(8-14-25)28(31,32)33,26-15-9-23(10-16-26)29(34,35)36,27-17-11-24(12-18-27)30(37,38)39)42-44(40,41)20-19-21-5-3-2-4-6-21/h2-20H,1H3.
What are the key properties of [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate?
[methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate has a molecular weight of 664.53 g/mol, XLogP of 8.13, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-tris[4-(trifluoromethyl)phenyl]-λ5-phosphanyl] 2-phenylethenesulfonate is sourced from PubChem (CID 173392918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).