About (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate
(2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate (PubChem CID 57257063) has the molecular formula C13H16O5S
and a molecular weight of 284.33 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate |
| PubChem CID | 57257063 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate |
| SMILES | CC(C)(C)OC(=O)OS(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C13H16O5S/c1-13(2,3)17-12(14)18-19(15,16)10-9-11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | CUHWMAAJSAFCMJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate?
The IUPAC name of (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate (CID 57257063) is (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate.
What is the SMILES notation for (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate?
The canonical SMILES for (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate is CC(C)(C)OC(=O)OS(=O)(=O)C=Cc1ccccc1.
What is the InChIKey of (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate?
The InChIKey is CUHWMAAJSAFCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5S/c1-13(2,3)17-12(14)18-19(15,16)10-9-11-7-5-4-6-8-11/h4-10H,1-3H3.
What are the key properties of (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate?
(2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate has a molecular weight of 284.33 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxycarbonyl 2-phenylethenesulfonate is sourced from PubChem (CID 57257063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).