About sodium;hydride;propyl 2-phenylethenesulfonate
sodium;hydride;propyl 2-phenylethenesulfonate (PubChem CID 174467762) has the molecular formula C11H15NaO3S
and a molecular weight of 250.30 g/mol. Its IUPAC name is sodium;hydride;propyl 2-phenylethenesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;propyl 2-phenylethenesulfonate |
| PubChem CID | 174467762 |
| Molecular Formula | C11H15NaO3S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | sodium;hydride;propyl 2-phenylethenesulfonate |
| SMILES | CCCOS(=O)(=O)C=Cc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C11H14O3S.Na.H/c1-2-9-14-15(12,13)10-8-11-6-4-3-5-7-11;;/h3-8,10H,2,9H2,1H3;;/q;+1;-1 |
| InChIKey | RYBWMEJTRQXNHZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;propyl 2-phenylethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;propyl 2-phenylethenesulfonate?
The IUPAC name of sodium;hydride;propyl 2-phenylethenesulfonate (CID 174467762) is sodium;hydride;propyl 2-phenylethenesulfonate.
What is the SMILES notation for sodium;hydride;propyl 2-phenylethenesulfonate?
The canonical SMILES for sodium;hydride;propyl 2-phenylethenesulfonate is CCCOS(=O)(=O)C=Cc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;propyl 2-phenylethenesulfonate?
The InChIKey is RYBWMEJTRQXNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S.Na.H/c1-2-9-14-15(12,13)10-8-11-6-4-3-5-7-11;;/h3-8,10H,2,9H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;propyl 2-phenylethenesulfonate?
sodium;hydride;propyl 2-phenylethenesulfonate has a molecular weight of 250.30 g/mol, XLogP of -0.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;propyl 2-phenylethenesulfonate is sourced from PubChem (CID 174467762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).