C27H34O5 — CID 67574131
tert-butyl 2-phenylethenyl carbonate;2-phenylethenyl 2,2-dimethylbutanoate (PubChem CID 67574131) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is tert-butyl 2-phenylethenyl carbonate;2-phenylethenyl 2,2-dimethylbutanoate.
| Compound Name | tert-butyl 2-phenylethenyl carbonate;2-phenylethenyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67574131 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | tert-butyl 2-phenylethenyl carbonate;2-phenylethenyl 2,2-dimethylbutanoate |
| SMILES | CC(C)(C)OC(=O)OC=Cc1ccccc1.CCC(C)(C)C(=O)OC=Cc1ccccc1 |
| InChI | InChI=1S/C14H18O2.C13H16O3/c1-4-14(2,3)13(15)16-11-10-12-8-6-5-7-9-12;1-13(2,3)16-12(14)15-10-9-11-7-5-4-6-8-11/h5-11H,4H2,1-3H3;4-10H,1-3H3 |
| InChIKey | LPHLPSQLLTZUSP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|