About 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate
2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 174554152) has the molecular formula C17H17NO5S
and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 174554152 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)OS(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO5S/c18-16(12-14-6-8-15(19)9-7-14)17(20)23-24(21,22)11-10-13-4-2-1-3-5-13/h1-11,16,19H,12,18H2/t16-/m0/s1 |
| InChIKey | NVUIVXBBDWUSGG-INIZCTEOSA-N |
| XLogP | 1.81 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The IUPAC name of 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (CID 174554152) is 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is N[C@@H](Cc1ccc(O)cc1)C(=O)OS(=O)(=O)C=Cc1ccccc1.
What is the InChIKey of 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
The InChIKey is NVUIVXBBDWUSGG-INIZCTEOSA-N. The full InChI is InChI=1S/C17H17NO5S/c18-16(12-14-6-8-15(19)9-7-14)17(20)23-24(21,22)11-10-13-4-2-1-3-5-13/h1-11,16,19H,12,18H2/t16-/m0/s1.
What are the key properties of 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate?
2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate has a molecular weight of 347.39 g/mol, XLogP of 1.81, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenylsulfonyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 174554152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).