C20H35NaO3 — CID 173396889
sodium;(1,2-diethoxy-3,3-dimethyloctan-2-yl)oxybenzene;hydride (PubChem CID 173396889) has the molecular formula C20H35NaO3 and a molecular weight of 346.49 g/mol. Its IUPAC name is sodium;(1,2-diethoxy-3,3-dimethyloctan-2-yl)oxybenzene;hydride.
| Compound Name | sodium;(1,2-diethoxy-3,3-dimethyloctan-2-yl)oxybenzene;hydride |
|---|---|
| PubChem CID | 173396889 |
| Molecular Formula | C20H35NaO3 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | sodium;(1,2-diethoxy-3,3-dimethyloctan-2-yl)oxybenzene;hydride |
| SMILES | CCCCCC(C)(C)C(COCC)(OCC)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C20H34O3.Na.H/c1-6-9-13-16-19(4,5)20(22-8-3,17-21-7-2)23-18-14-11-10-12-15-18;;/h10-12,14-15H,6-9,13,16-17H2,1-5H3;;/q;+1;-1 |
| InChIKey | QWKQWJOMFYJNFW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|