C17H28O4S — CID 173397072
2-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylacetic acid (PubChem CID 173397072) has the molecular formula C17H28O4S and a molecular weight of 328.47 g/mol. Its IUPAC name is 2-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylacetic acid.
| Compound Name | 2-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 173397072 |
| Molecular Formula | C17H28O4S |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylacetic acid |
| SMILES | CC(=CCO)CCC=C(C)CCC(=O)C(C)CSCC(=O)O |
| InChI | InChI=1S/C17H28O4S/c1-13(5-4-6-14(2)9-10-18)7-8-16(19)15(3)11-22-12-17(20)21/h5,9,15,18H,4,6-8,10-12H2,1-3H3,(H,20,21) |
| InChIKey | JHOOUOFXJXSQMA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|