C19H33NO3S — CID 173402088
N-[1-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylethyl]acetamide (PubChem CID 173402088) has the molecular formula C19H33NO3S and a molecular weight of 355.54 g/mol. Its IUPAC name is N-[1-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylethyl]acetamide.
| Compound Name | N-[1-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 173402088 |
| Molecular Formula | C19H33NO3S |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | N-[1-(12-hydroxy-2,6,10-trimethyl-3-oxododeca-6,10-dienyl)sulfanylethyl]acetamide |
| SMILES | CC(=O)NC(C)SCC(C)C(=O)CCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C19H33NO3S/c1-14(7-6-8-15(2)11-12-21)9-10-19(23)16(3)13-24-18(5)20-17(4)22/h7,11,16,18,21H,6,8-10,12-13H2,1-5H3,(H,20,22) |
| InChIKey | CFJQMDOJKVCTAC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|