About benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium
benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium (PubChem CID 173397692) has the molecular formula C27H24ClO3PS
and a molecular weight of 494.98 g/mol. Its IUPAC name is benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium.
Molecular Properties
| Compound Name | benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium |
| PubChem CID | 173397692 |
| Molecular Formula | C27H24ClO3PS |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium |
| SMILES | Cl[P+](CC=Cc1ccccc1)(c1ccccc1)c1ccccc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C21H19ClP.C6H6O3S/c22-23(20-14-6-2-7-15-20,21-16-8-3-9-17-21)18-10-13-19-11-4-1-5-12-19;7-10(8,9)6-4-2-1-3-5-6/h1-17H,18H2;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | GUUYIZXGCYKXDS-UHFFFAOYSA-M |
| XLogP | 6.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium?
The IUPAC name of benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium (CID 173397692) is benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium.
What is the SMILES notation for benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium?
The canonical SMILES for benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium is Cl[P+](CC=Cc1ccccc1)(c1ccccc1)c1ccccc1.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium?
The InChIKey is GUUYIZXGCYKXDS-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H19ClP.C6H6O3S/c22-23(20-14-6-2-7-15-20,21-16-8-3-9-17-21)18-10-13-19-11-4-1-5-12-19;7-10(8,9)6-4-2-1-3-5-6/h1-17H,18H2;1-5H,(H,7,8,9)/q+1;/p-1.
What are the key properties of benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium?
benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium has a molecular weight of 494.98 g/mol, XLogP of 6.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;chloro-diphenyl-(3-phenylprop-2-enyl)phosphanium is sourced from PubChem (CID 173397692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).