C21H23O5PS — CID 173398080
3-hydroxy-4-methylbenzenesulfonic acid;(4-methoxyphenyl)methyl-phenylphosphane (PubChem CID 173398080) has the molecular formula C21H23O5PS and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-hydroxy-4-methylbenzenesulfonic acid;(4-methoxyphenyl)methyl-phenylphosphane.
| Compound Name | 3-hydroxy-4-methylbenzenesulfonic acid;(4-methoxyphenyl)methyl-phenylphosphane |
|---|---|
| PubChem CID | 173398080 |
| Molecular Formula | C21H23O5PS |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3-hydroxy-4-methylbenzenesulfonic acid;(4-methoxyphenyl)methyl-phenylphosphane |
| SMILES | COc1ccc(CPc2ccccc2)cc1.Cc1ccc(S(=O)(=O)O)cc1O |
| InChI | InChI=1S/C14H15OP.C7H8O4S/c1-15-13-9-7-12(8-10-13)11-16-14-5-3-2-4-6-14;1-5-2-3-6(4-7(5)8)12(9,10)11/h2-10,16H,11H2,1H3;2-4,8H,1H3,(H,9,10,11) |
| InChIKey | CDFMGBSOLKKNHH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|