C15H16F3O4PS — CID 162621456
(4-methoxyphenyl)methyl-phenylphosphane;trifluoromethanesulfonic acid (PubChem CID 162621456) has the molecular formula C15H16F3O4PS and a molecular weight of 380.32 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-phenylphosphane;trifluoromethanesulfonic acid.
| Compound Name | (4-methoxyphenyl)methyl-phenylphosphane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162621456 |
| Molecular Formula | C15H16F3O4PS |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (4-methoxyphenyl)methyl-phenylphosphane;trifluoromethanesulfonic acid |
| SMILES | COc1ccc(CPc2ccccc2)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C14H15OP.CHF3O3S/c1-15-13-9-7-12(8-10-13)11-16-14-5-3-2-4-6-14;2-1(3,4)8(5,6)7/h2-10,16H,11H2,1H3;(H,5,6,7) |
| InChIKey | QWLWFHFGDWHYOG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|