C28H29O6PS — CID 173366161
bis(4-methoxyphenyl)methyl-phenylphosphane;5-hydroxy-2-methylbenzenesulfonic acid (PubChem CID 173366161) has the molecular formula C28H29O6PS and a molecular weight of 524.58 g/mol. Its IUPAC name is bis(4-methoxyphenyl)methyl-phenylphosphane;5-hydroxy-2-methylbenzenesulfonic acid.
| Compound Name | bis(4-methoxyphenyl)methyl-phenylphosphane;5-hydroxy-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173366161 |
| Molecular Formula | C28H29O6PS |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | bis(4-methoxyphenyl)methyl-phenylphosphane;5-hydroxy-2-methylbenzenesulfonic acid |
| SMILES | COc1ccc(C(Pc2ccccc2)c2ccc(OC)cc2)cc1.Cc1ccc(O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H21O2P.C7H8O4S/c1-22-18-12-8-16(9-13-18)21(24-20-6-4-3-5-7-20)17-10-14-19(23-2)15-11-17;1-5-2-3-6(8)4-7(5)12(9,10)11/h3-15,21,24H,1-2H3;2-4,8H,1H3,(H,9,10,11) |
| InChIKey | UAVUVFAZXJBUHC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|