C17H38 — CID 173400294
4-methyl-1-tritiopentane;4,4,5-trimethyloctane (PubChem CID 173400294) has the molecular formula C17H38 and a molecular weight of 244.50 g/mol. Its IUPAC name is 4-methyl-1-tritiopentane;4,4,5-trimethyloctane.
| Compound Name | 4-methyl-1-tritiopentane;4,4,5-trimethyloctane |
|---|---|
| PubChem CID | 173400294 |
| Molecular Formula | C17H38 |
| Molecular Weight | 244.50 g/mol |
| Exact Mass | 244.31 |
| IUPAC Name | 4-methyl-1-tritiopentane;4,4,5-trimethyloctane |
| SMILES | CCCC(C)C(C)(C)CCC.[3H]CCCC(C)C |
| InChI | InChI=1S/C11H24.C6H14/c1-6-8-10(3)11(4,5)9-7-2;1-4-5-6(2)3/h10H,6-9H2,1-5H3;6H,4-5H2,1-3H3/i;1T |
| InChIKey | AEGUCGYQQNZDCY-WMTCLNHOSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |