C18H38N2 — CID 173404714
N-dodecyl-N,N',N'-trimethylprop-1-ene-1,3-diamine (PubChem CID 173404714) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is N-dodecyl-N,N',N'-trimethylprop-1-ene-1,3-diamine.
| Compound Name | N-dodecyl-N,N',N'-trimethylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 173404714 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N-dodecyl-N,N',N'-trimethylprop-1-ene-1,3-diamine |
| SMILES | CCCCCCCCCCCCN(C)C=CCN(C)C |
| InChI | InChI=1S/C18H38N2/c1-5-6-7-8-9-10-11-12-13-14-17-20(4)18-15-16-19(2)3/h15,18H,5-14,16-17H2,1-4H3 |
| InChIKey | DONKZNSVPDVWBM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|