C17H28Cl2O — CID 173405272
5,7-bis(3-chloroprop-2-enyl)undecan-6-one (PubChem CID 173405272) has the molecular formula C17H28Cl2O and a molecular weight of 319.32 g/mol. Its IUPAC name is 5,7-bis(3-chloroprop-2-enyl)undecan-6-one.
| Compound Name | 5,7-bis(3-chloroprop-2-enyl)undecan-6-one |
|---|---|
| PubChem CID | 173405272 |
| Molecular Formula | C17H28Cl2O |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5,7-bis(3-chloroprop-2-enyl)undecan-6-one |
| SMILES | CCCCC(CC=CCl)C(=O)C(CC=CCl)CCCC |
| InChI | InChI=1S/C17H28Cl2O/c1-3-5-9-15(11-7-13-18)17(20)16(10-6-4-2)12-8-14-19/h7-8,13-16H,3-6,9-12H2,1-2H3 |
| InChIKey | QRFNXSIHYRONKA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |