C19H32Cl3N — CID 173407420
5-(3-butyl-2,4-dichlorophenyl)nonan-5-amine;hydrochloride (PubChem CID 173407420) has the molecular formula C19H32Cl3N and a molecular weight of 380.83 g/mol. Its IUPAC name is 5-(3-butyl-2,4-dichlorophenyl)nonan-5-amine;hydrochloride.
| Compound Name | 5-(3-butyl-2,4-dichlorophenyl)nonan-5-amine;hydrochloride |
|---|---|
| PubChem CID | 173407420 |
| Molecular Formula | C19H32Cl3N |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 5-(3-butyl-2,4-dichlorophenyl)nonan-5-amine;hydrochloride |
| SMILES | CCCCc1c(Cl)ccc(C(N)(CCCC)CCCC)c1Cl.Cl |
| InChI | InChI=1S/C19H31Cl2N.ClH/c1-4-7-10-15-17(20)12-11-16(18(15)21)19(22,13-8-5-2)14-9-6-3;/h11-12H,4-10,13-14,22H2,1-3H3;1H |
| InChIKey | WBKLPWAWDKXVGM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |