C8H9N4O2S+ — CID 173425581
1-pyridin-2-ylsulfonyl-1,2-dihydro-1,3,5-triazin-1-ium (PubChem CID 173425581) has the molecular formula C8H9N4O2S+ and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-pyridin-2-ylsulfonyl-1,2-dihydro-1,3,5-triazin-1-ium.
| Compound Name | 1-pyridin-2-ylsulfonyl-1,2-dihydro-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 173425581 |
| Molecular Formula | C8H9N4O2S+ |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-pyridin-2-ylsulfonyl-1,2-dihydro-1,3,5-triazin-1-ium |
| SMILES | O=S(=O)(c1ccccn1)[NH+]1C=NC=NC1 |
| InChI | InChI=1S/C8H8N4O2S/c13-15(14,8-3-1-2-4-11-8)12-6-9-5-10-7-12/h1-6H,7H2/p+1 |
| InChIKey | SEUARJJFSXYSKH-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |