C12H18O4 — CID 173426020
2,2-dimethyl-3-[3-(3-oxopropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 173426020) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3-(3-oxopropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-[3-(3-oxopropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 173426020 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,2-dimethyl-3-[3-(3-oxopropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=CCOCCC=O)C1C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-12(2)9(10(12)11(14)15)5-3-7-16-8-4-6-13/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | KKQVDZHMUPAOIP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|