C30H60O8 — CID 173429832
acetic acid;dodecanoic acid;bis(2-ethylhexanoic acid) (PubChem CID 173429832) has the molecular formula C30H60O8 and a molecular weight of 548.80 g/mol. Its IUPAC name is acetic acid;dodecanoic acid;bis(2-ethylhexanoic acid).
| Compound Name | acetic acid;dodecanoic acid;bis(2-ethylhexanoic acid) |
|---|---|
| PubChem CID | 173429832 |
| Molecular Formula | C30H60O8 |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | acetic acid;dodecanoic acid;bis(2-ethylhexanoic acid) |
| SMILES | CC(=O)O.CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O2.2C8H16O2.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;2*1-3-5-6-7(4-2)8(9)10;1-2(3)4/h2-11H2,1H3,(H,13,14);2*7H,3-6H2,1-2H3,(H,9,10);1H3,(H,3,4) |
| InChIKey | VSZCDCWZDQRCBU-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|