About 2-ethylbutanoic acid;hexadecanoic acid
2-ethylbutanoic acid;hexadecanoic acid (PubChem CID 174469732) has the molecular formula C22H44O4
and a molecular weight of 372.59 g/mol. Its IUPAC name is 2-ethylbutanoic acid;hexadecanoic acid.
Molecular Properties
| Compound Name | 2-ethylbutanoic acid;hexadecanoic acid |
| PubChem CID | 174469732 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 2-ethylbutanoic acid;hexadecanoic acid |
| SMILES | CCC(CC)C(=O)O.CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2.C6H12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-3-5(4-2)6(7)8/h2-15H2,1H3,(H,17,18);5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | BJDXHRDBOAVPJE-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutanoic acid;hexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutanoic acid;hexadecanoic acid?
The IUPAC name of 2-ethylbutanoic acid;hexadecanoic acid (CID 174469732) is 2-ethylbutanoic acid;hexadecanoic acid.
What is the SMILES notation for 2-ethylbutanoic acid;hexadecanoic acid?
The canonical SMILES for 2-ethylbutanoic acid;hexadecanoic acid is CCC(CC)C(=O)O.CCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-ethylbutanoic acid;hexadecanoic acid?
The InChIKey is BJDXHRDBOAVPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C6H12O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-3-5(4-2)6(7)8/h2-15H2,1H3,(H,17,18);5H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 2-ethylbutanoic acid;hexadecanoic acid?
2-ethylbutanoic acid;hexadecanoic acid has a molecular weight of 372.59 g/mol, XLogP of 7.06, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutanoic acid;hexadecanoic acid is sourced from PubChem (CID 174469732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).