C22H28I2N8 — CID 173435898
2-[[10-[[[amino(dimethylamino)methylidene]hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-1,1-dimethylguanidine;dihydroiodide (PubChem CID 173435898) has the molecular formula C22H28I2N8 and a molecular weight of 658.33 g/mol. Its IUPAC name is 2-[[10-[[[amino(dimethylamino)methylidene]hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-1,1-dimethylguanidine;dihydroiodide.
| Compound Name | 2-[[10-[[[amino(dimethylamino)methylidene]hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-1,1-dimethylguanidine;dihydroiodide |
|---|---|
| PubChem CID | 173435898 |
| Molecular Formula | C22H28I2N8 |
| Molecular Weight | 658.33 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | 2-[[10-[[[amino(dimethylamino)methylidene]hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-1,1-dimethylguanidine;dihydroiodide |
| SMILES | CN(C)C(N)=NN=Cc1c2ccccc2c(C=NN=C(N)N(C)C)c2ccccc12.I.I |
| InChI | InChI=1S/C22H26N8.2HI/c1-29(2)21(23)27-25-13-19-15-9-5-7-11-17(15)20(14-26-28-22(24)30(3)4)18-12-8-6-10-16(18)19;;/h5-14H,1-4H3,(H2,23,27)(H2,24,28);2*1H |
| InChIKey | JVCAUYRAKSQFFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|