C7H9N3O4 — CID 173438684
methyl 4-(2-hydroxy-3-oxopropyl)-1,2,4-triazole-3-carboxylate (PubChem CID 173438684) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is methyl 4-(2-hydroxy-3-oxopropyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 4-(2-hydroxy-3-oxopropyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 173438684 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | methyl 4-(2-hydroxy-3-oxopropyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nncn1CC(O)C=O |
| InChI | InChI=1S/C7H9N3O4/c1-14-7(13)6-9-8-4-10(6)2-5(12)3-11/h3-5,12H,2H2,1H3 |
| InChIKey | DAIRQCWZIMQXHD-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|