About S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate
S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate (PubChem CID 173441086) has the molecular formula C15H15ClN2OS
and a molecular weight of 306.82 g/mol. Its IUPAC name is S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate.
Molecular Properties
| Compound Name | S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate |
| PubChem CID | 173441086 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate |
| SMILES | C=CCSC(=O)C(C#N)=C(C)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN2OS/c1-3-7-20-15(19)14(9-17)11(2)18-10-12-5-4-6-13(16)8-12/h3-6,8,18H,1,7,10H2,2H3 |
| InChIKey | ZBPFIFVYGGDWPA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate?
The IUPAC name of S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate (CID 173441086) is S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate.
What is the SMILES notation for S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate?
The canonical SMILES for S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate is C=CCSC(=O)C(C#N)=C(C)NCc1cccc(Cl)c1.
What is the InChIKey of S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate?
The InChIKey is ZBPFIFVYGGDWPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2OS/c1-3-7-20-15(19)14(9-17)11(2)18-10-12-5-4-6-13(16)8-12/h3-6,8,18H,1,7,10H2,2H3.
What are the key properties of S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate?
S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate has a molecular weight of 306.82 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl 3-[(3-chlorophenyl)methylamino]-2-cyanobut-2-enethioate is sourced from PubChem (CID 173441086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).