C12H13N3O9 — CID 173441540
3,5-dinitrobenzoic acid;3-methyl-4-nitrobut-2-en-1-ol (PubChem CID 173441540) has the molecular formula C12H13N3O9 and a molecular weight of 343.25 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid;3-methyl-4-nitrobut-2-en-1-ol.
| Compound Name | 3,5-dinitrobenzoic acid;3-methyl-4-nitrobut-2-en-1-ol |
|---|---|
| PubChem CID | 173441540 |
| Molecular Formula | C12H13N3O9 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3,5-dinitrobenzoic acid;3-methyl-4-nitrobut-2-en-1-ol |
| SMILES | CC(=CCO)C[N+](=O)[O-].O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O6.C5H9NO3/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;1-5(2-3-7)4-6(8)9/h1-3H,(H,10,11);2,7H,3-4H2,1H3 |
| InChIKey | JQZRMXKJMMYLNM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|