About sodium;N,N-diethylhydroxylamine;hydride
sodium;N,N-diethylhydroxylamine;hydride (PubChem CID 173441828) has the molecular formula C4H12NNaO
and a molecular weight of 113.14 g/mol. Its IUPAC name is sodium;N,N-diethylhydroxylamine;hydride.
Molecular Properties
| Compound Name | sodium;N,N-diethylhydroxylamine;hydride |
| PubChem CID | 173441828 |
| Molecular Formula | C4H12NNaO |
| Molecular Weight | 113.14 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | sodium;N,N-diethylhydroxylamine;hydride |
| SMILES | CCN(O)CC.[H-].[Na+] |
| InChI | InChI=1S/C4H11NO.Na.H/c1-3-5(6)4-2;;/h6H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | PKXRNTBTXSNIFL-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.14 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;N,N-diethylhydroxylamine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N,N-diethylhydroxylamine;hydride?
The IUPAC name of sodium;N,N-diethylhydroxylamine;hydride (CID 173441828) is sodium;N,N-diethylhydroxylamine;hydride.
What is the SMILES notation for sodium;N,N-diethylhydroxylamine;hydride?
The canonical SMILES for sodium;N,N-diethylhydroxylamine;hydride is CCN(O)CC.[H-].[Na+].
What is the InChIKey of sodium;N,N-diethylhydroxylamine;hydride?
The InChIKey is PKXRNTBTXSNIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.Na.H/c1-3-5(6)4-2;;/h6H,3-4H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;N,N-diethylhydroxylamine;hydride?
sodium;N,N-diethylhydroxylamine;hydride has a molecular weight of 113.14 g/mol, XLogP of -2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N,N-diethylhydroxylamine;hydride is sourced from PubChem (CID 173441828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).