C4H12NNaO — CID 173441828
sodium;N,N-diethylhydroxylamine;hydride (PubChem CID 173441828) has the molecular formula C4H12NNaO and a molecular weight of 113.14 g/mol. Its IUPAC name is sodium;N,N-diethylhydroxylamine;hydride.
| Compound Name | sodium;N,N-diethylhydroxylamine;hydride |
|---|---|
| PubChem CID | 173441828 |
| Molecular Formula | C4H12NNaO |
| Molecular Weight | 113.14 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | sodium;N,N-diethylhydroxylamine;hydride |
| SMILES | CCN(O)CC.[H-].[Na+] |
| InChI | InChI=1S/C4H11NO.Na.H/c1-3-5(6)4-2;;/h6H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | PKXRNTBTXSNIFL-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.14 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|