N,N-diethylhydroxylamine;2-hydroxyacetic acid

C6H15NO4 — CID 173174069

IUPACN,N-diethylhydroxylamine;2-hydroxyacetic acid
SMILESCCN(O)CC.O=C(O)CO
InChIInChI=1S/C4H11NO.C2H4O3/c1-3-5(6)4-2;3-1-2(4)5/h6H,3-4H2,1-2H3;3H,1H2,(H,4,5)
InChIKeyXCZSAORBPCKBLS-UHFFFAOYSA-N
MW165.19 g/mol
LogP-0.22
Rot. Bonds3

About N,N-diethylhydroxylamine;2-hydroxyacetic acid

N,N-diethylhydroxylamine;2-hydroxyacetic acid (PubChem CID 173174069) has the molecular formula C6H15NO4 and a molecular weight of 165.19 g/mol. Its IUPAC name is N,N-diethylhydroxylamine;2-hydroxyacetic acid.

Molecular Properties

Compound NameN,N-diethylhydroxylamine;2-hydroxyacetic acid
PubChem CID173174069
Molecular FormulaC6H15NO4
Molecular Weight165.19 g/mol
Exact Mass165.10
IUPAC NameN,N-diethylhydroxylamine;2-hydroxyacetic acid
SMILESCCN(O)CC.O=C(O)CO
InChIInChI=1S/C4H11NO.C2H4O3/c1-3-5(6)4-2;3-1-2(4)5/h6H,3-4H2,1-2H3;3H,1H2,(H,4,5)
InChIKeyXCZSAORBPCKBLS-UHFFFAOYSA-N
XLogP-0.22
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.19
LogP ≤ 5-0.22
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N,N-diethylhydroxylamine;2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylhydroxylamine;2-hydroxyacetic acid?
The IUPAC name of N,N-diethylhydroxylamine;2-hydroxyacetic acid (CID 173174069) is N,N-diethylhydroxylamine;2-hydroxyacetic acid.
What is the SMILES notation for N,N-diethylhydroxylamine;2-hydroxyacetic acid?
The canonical SMILES for N,N-diethylhydroxylamine;2-hydroxyacetic acid is CCN(O)CC.O=C(O)CO.
What is the InChIKey of N,N-diethylhydroxylamine;2-hydroxyacetic acid?
The InChIKey is XCZSAORBPCKBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C2H4O3/c1-3-5(6)4-2;3-1-2(4)5/h6H,3-4H2,1-2H3;3H,1H2,(H,4,5).
What are the key properties of N,N-diethylhydroxylamine;2-hydroxyacetic acid?
N,N-diethylhydroxylamine;2-hydroxyacetic acid has a molecular weight of 165.19 g/mol, XLogP of -0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylhydroxylamine;2-hydroxyacetic acid is sourced from PubChem (CID 173174069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).